C8H12F4N6O — CID 106294470
4-ethoxy-6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine (PubChem CID 106294470) has the molecular formula C8H12F4N6O and a molecular weight of 284.22 g/mol. Its IUPAC name is 4-ethoxy-6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106294470 |
| Molecular Formula | C8H12F4N6O |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-ethoxy-6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NN)nc(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H12F4N6O/c1-2-19-7-16-5(15-6(17-7)18-13)14-3-8(11,12)4(9)10/h4H,2-3,13H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | IYDGOQHSPXABCX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|