C10H16F3N5OS — CID 106434023
6-ethoxy-4-N-ethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 106434023) has the molecular formula C10H16F3N5OS and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-ethoxy-4-N-ethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-4-N-ethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106434023 |
| Molecular Formula | C10H16F3N5OS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6-ethoxy-4-N-ethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCCSC(F)(F)F)nc(OCC)n1 |
| InChI | InChI=1S/C10H16F3N5OS/c1-3-14-7-16-8(18-9(17-7)19-4-2)15-5-6-20-10(11,12)13/h3-6H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | GXZFUTLTJXQTIV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|