C8H5Cl3F4N2 — CID 106293428
3,5,6-trichloro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine (PubChem CID 106293428) has the molecular formula C8H5Cl3F4N2 and a molecular weight of 311.49 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106293428 |
| Molecular Formula | C8H5Cl3F4N2 |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 3,5,6-trichloro-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine |
| SMILES | FC(F)C(F)(F)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl3F4N2/c9-3-1-4(10)6(17-5(3)11)16-2-8(14,15)7(12)13/h1,7H,2H2,(H,16,17) |
| InChIKey | WSRFXAYDDASAQA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|