C8H9Cl3N2O — CID 102750353
1-[(3,5,6-trichloro-2-pyridinyl)amino]propan-2-ol (PubChem CID 102750353) has the molecular formula C8H9Cl3N2O and a molecular weight of 255.53 g/mol. Its IUPAC name is 1-[(3,5,6-trichloro-2-pyridinyl)amino]propan-2-ol.
| Compound Name | 1-[(3,5,6-trichloro-2-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 102750353 |
| Molecular Formula | C8H9Cl3N2O |
| Molecular Weight | 255.53 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 1-[(3,5,6-trichloro-2-pyridinyl)amino]propan-2-ol |
| SMILES | CC(O)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl3N2O/c1-4(14)3-12-8-6(10)2-5(9)7(11)13-8/h2,4,14H,3H2,1H3,(H,12,13) |
| InChIKey | QIWZKIOTMTXMCG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|