About 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol
1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol (PubChem CID 107159718) has the molecular formula C12H19Cl2N3O
and a molecular weight of 292.21 g/mol. Its IUPAC name is 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol.
Molecular Properties
| Compound Name | 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol |
| PubChem CID | 107159718 |
| Molecular Formula | C12H19Cl2N3O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol |
| SMILES | CNc1nc(NCC(O)CC(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H19Cl2N3O/c1-7(2)4-8(18)6-16-12-10(14)5-9(13)11(15-3)17-12/h5,7-8,18H,4,6H2,1-3H3,(H2,15,16,17) |
| InChIKey | ZLCREMKJVSIYHM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol?
The IUPAC name of 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol (CID 107159718) is 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol.
What is the SMILES notation for 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol?
The canonical SMILES for 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol is CNc1nc(NCC(O)CC(C)C)c(Cl)cc1Cl.
What is the InChIKey of 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol?
The InChIKey is ZLCREMKJVSIYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19Cl2N3O/c1-7(2)4-8(18)6-16-12-10(14)5-9(13)11(15-3)17-12/h5,7-8,18H,4,6H2,1-3H3,(H2,15,16,17).
What are the key properties of 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol?
1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol has a molecular weight of 292.21 g/mol, XLogP of 3.25, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-4-methylpentan-2-ol is sourced from PubChem (CID 107159718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).