C16H27Cl2N3 — CID 102759054
3,5-dichloro-6-N-decyl-2-N-methylpyridine-2,6-diamine (PubChem CID 102759054) has the molecular formula C16H27Cl2N3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 3,5-dichloro-6-N-decyl-2-N-methylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-decyl-2-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102759054 |
| Molecular Formula | C16H27Cl2N3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3,5-dichloro-6-N-decyl-2-N-methylpyridine-2,6-diamine |
| SMILES | CCCCCCCCCCNc1nc(NC)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H27Cl2N3/c1-3-4-5-6-7-8-9-10-11-20-16-14(18)12-13(17)15(19-2)21-16/h12H,3-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | ICDYJXHRKQVNCH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|