C9H10Cl2F3N3S — CID 114188400
3,5-dichloro-2-N-methyl-6-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2,6-diamine (PubChem CID 114188400) has the molecular formula C9H10Cl2F3N3S and a molecular weight of 320.17 g/mol. Its IUPAC name is 3,5-dichloro-2-N-methyl-6-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-2-N-methyl-6-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 114188400 |
| Molecular Formula | C9H10Cl2F3N3S |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3,5-dichloro-2-N-methyl-6-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2,6-diamine |
| SMILES | CNc1nc(NCCSC(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2F3N3S/c1-15-7-5(10)4-6(11)8(17-7)16-2-3-18-9(12,13)14/h4H,2-3H2,1H3,(H2,15,16,17) |
| InChIKey | SNACULXTHTYTGS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|