C10H11ClF3N3OS — CID 106433045
5-chloro-6-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide (PubChem CID 106433045) has the molecular formula C10H11ClF3N3OS and a molecular weight of 313.73 g/mol. Its IUPAC name is 5-chloro-6-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106433045 |
| Molecular Formula | C10H11ClF3N3OS |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-chloro-6-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide |
| SMILES | CNc1ncc(C(=O)NCCSC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3N3OS/c1-15-8-7(11)4-6(5-17-8)9(18)16-2-3-19-10(12,13)14/h4-5H,2-3H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | FCIHVTSIWBSMLF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|