C10H10ClF3N2OS — CID 104952363
2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide (PubChem CID 104952363) has the molecular formula C10H10ClF3N2OS and a molecular weight of 298.72 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104952363 |
| Molecular Formula | C10H10ClF3N2OS |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCSC(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C10H10ClF3N2OS/c1-6-4-7(5-8(11)16-6)9(17)15-2-3-18-10(12,13)14/h4-5H,2-3H2,1H3,(H,15,17) |
| InChIKey | OLNGECHKQRFRLQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|