C11H14Cl2N2OS — CID 115635819
2,6-dichloro-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide (PubChem CID 115635819) has the molecular formula C11H14Cl2N2OS and a molecular weight of 293.22 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115635819 |
| Molecular Formula | C11H14Cl2N2OS |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2,6-dichloro-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide |
| SMILES | CSCCCCNC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2OS/c1-17-5-3-2-4-14-11(16)8-6-9(12)15-10(13)7-8/h6-7H,2-5H2,1H3,(H,14,16) |
| InChIKey | CWUHFXACNSZHQV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|