C9H10Cl2N2OS — CID 60693650
2,6-dichloro-N-(2-methylsulfanylethyl)pyridine-4-carboxamide (PubChem CID 60693650) has the molecular formula C9H10Cl2N2OS and a molecular weight of 265.17 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-methylsulfanylethyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(2-methylsulfanylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60693650 |
| Molecular Formula | C9H10Cl2N2OS |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2,6-dichloro-N-(2-methylsulfanylethyl)pyridine-4-carboxamide |
| SMILES | CSCCNC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2OS/c1-15-3-2-12-9(14)6-4-7(10)13-8(11)5-6/h4-5H,2-3H2,1H3,(H,12,14) |
| InChIKey | JNPFPEGLDYJUND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|