C18H22N2O2S2 — CID 58451849
2-N,6-N-bis(2-methylsulfanylethyl)naphthalene-2,6-dicarboxamide (PubChem CID 58451849) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-N,6-N-bis(2-methylsulfanylethyl)naphthalene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(2-methylsulfanylethyl)naphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 58451849 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-N,6-N-bis(2-methylsulfanylethyl)naphthalene-2,6-dicarboxamide |
| SMILES | CSCCNC(=O)c1ccc2cc(C(=O)NCCSC)ccc2c1 |
| InChI | InChI=1S/C18H22N2O2S2/c1-23-9-7-19-17(21)15-5-3-14-12-16(6-4-13(14)11-15)18(22)20-8-10-24-2/h3-6,11-12H,7-10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VMHLJHXCEVNYOT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|