C10H12Cl2N2OS — CID 112698010
2,6-dichloro-N-methyl-N-(2-methylsulfanylethyl)pyridine-4-carboxamide (PubChem CID 112698010) has the molecular formula C10H12Cl2N2OS and a molecular weight of 279.19 g/mol. Its IUPAC name is 2,6-dichloro-N-methyl-N-(2-methylsulfanylethyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-methyl-N-(2-methylsulfanylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112698010 |
| Molecular Formula | C10H12Cl2N2OS |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2,6-dichloro-N-methyl-N-(2-methylsulfanylethyl)pyridine-4-carboxamide |
| SMILES | CSCCN(C)C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2OS/c1-14(3-4-16-2)10(15)7-5-8(11)13-9(12)6-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | XLRONMKMLKDGJM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|