C12H17Cl2N3O — CID 55226569
2,6-dichloro-N-[3-(dimethylamino)propyl]-N-methylpyridine-4-carboxamide (PubChem CID 55226569) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-(dimethylamino)propyl]-N-methylpyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[3-(dimethylamino)propyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 55226569 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2,6-dichloro-N-[3-(dimethylamino)propyl]-N-methylpyridine-4-carboxamide |
| SMILES | CN(C)CCCN(C)C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N3O/c1-16(2)5-4-6-17(3)12(18)9-7-10(13)15-11(14)8-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | ASNOZWRYMHRKEP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|