C10H11ClN4O — CID 62153601
2-amino-6-chloro-N-(2-cyanoethyl)-N-methylpyridine-4-carboxamide (PubChem CID 62153601) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 2-amino-6-chloro-N-(2-cyanoethyl)-N-methylpyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-(2-cyanoethyl)-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 62153601 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-amino-6-chloro-N-(2-cyanoethyl)-N-methylpyridine-4-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C10H11ClN4O/c1-15(4-2-3-12)10(16)7-5-8(11)14-9(13)6-7/h5-6H,2,4H2,1H3,(H2,13,14) |
| InChIKey | IOSRIOIFPUXVHK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|