C13H17ClN4O — CID 62162054
2-amino-6-chloro-N-(2-cyanoethyl)-N-(2-methylpropyl)pyridine-4-carboxamide (PubChem CID 62162054) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 2-amino-6-chloro-N-(2-cyanoethyl)-N-(2-methylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-(2-cyanoethyl)-N-(2-methylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62162054 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-amino-6-chloro-N-(2-cyanoethyl)-N-(2-methylpropyl)pyridine-4-carboxamide |
| SMILES | CC(C)CN(CCC#N)C(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN4O/c1-9(2)8-18(5-3-4-15)13(19)10-6-11(14)17-12(16)7-10/h6-7,9H,3,5,8H2,1-2H3,(H2,16,17) |
| InChIKey | RKGNIZZQEPHNRX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|