C11H11ClN4OS — CID 62159832
2-amino-6-chloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-4-carboxamide (PubChem CID 62159832) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is 2-amino-6-chloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62159832 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-amino-6-chloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-4-carboxamide |
| SMILES | CN(Cc1cscn1)C(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN4OS/c1-16(4-8-5-18-6-14-8)11(17)7-2-9(12)15-10(13)3-7/h2-3,5-6H,4H2,1H3,(H2,13,15) |
| InChIKey | YQQHNCWPEUMYOC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|