C13H15N3OS — CID 55013339
4-amino-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)benzamide (PubChem CID 55013339) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-amino-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)benzamide.
| Compound Name | 4-amino-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55013339 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-amino-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)benzamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2cscn2)ccc1N |
| InChI | InChI=1S/C13H15N3OS/c1-9-5-10(3-4-12(9)14)13(17)16(2)6-11-7-18-8-15-11/h3-5,7-8H,6,14H2,1-2H3 |
| InChIKey | UANVGTDICJTMFS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|