C11H13N5OS — CID 62236807
4-hydrazinyl-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide (PubChem CID 62236807) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 4-hydrazinyl-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62236807 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-hydrazinyl-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyridine-2-carboxamide |
| SMILES | CN(Cc1cscn1)C(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C11H13N5OS/c1-16(5-9-6-18-7-14-9)11(17)10-4-8(15-12)2-3-13-10/h2-4,6-7H,5,12H2,1H3,(H,13,15) |
| InChIKey | VTCRLTBETZSTRW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|