C10H16N4OS — CID 112664397
4-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide (PubChem CID 112664397) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 112664397 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide |
| SMILES | CSCCN(C)C(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C10H16N4OS/c1-14(5-6-16-2)10(15)9-7-8(13-11)3-4-12-9/h3-4,7H,5-6,11H2,1-2H3,(H,12,13) |
| InChIKey | JXXPQFIPAJIIDF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|