C12H13BrN4OS — CID 62248535
N-[(4-bromothiophen-2-yl)methyl]-4-hydrazinyl-N-methylpyridine-2-carboxamide (PubChem CID 62248535) has the molecular formula C12H13BrN4OS and a molecular weight of 341.23 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-hydrazinyl-N-methylpyridine-2-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-hydrazinyl-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62248535 |
| Molecular Formula | C12H13BrN4OS |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-hydrazinyl-N-methylpyridine-2-carboxamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C12H13BrN4OS/c1-17(6-10-4-8(13)7-19-10)12(18)11-5-9(16-14)2-3-15-11/h2-5,7H,6,14H2,1H3,(H,15,16) |
| InChIKey | KBGSDDSOZVKBNK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|