C12H11Cl2N3OS — CID 55013795
3-amino-4,5-dichloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)benzamide (PubChem CID 55013795) has the molecular formula C12H11Cl2N3OS and a molecular weight of 316.21 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55013795 |
| Molecular Formula | C12H11Cl2N3OS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 3-amino-4,5-dichloro-N-methyl-N-(1,3-thiazol-4-ylmethyl)benzamide |
| SMILES | CN(Cc1cscn1)C(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3OS/c1-17(4-8-5-19-6-16-8)12(18)7-2-9(13)11(14)10(15)3-7/h2-3,5-6H,4,15H2,1H3 |
| InChIKey | XMKRJICQOSEOGI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|