C11H15Cl2N3O — CID 55226373
2,6-dichloro-N-[2-(dimethylamino)ethyl]-N-methylpyridine-4-carboxamide (PubChem CID 55226373) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(dimethylamino)ethyl]-N-methylpyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[2-(dimethylamino)ethyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 55226373 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2,6-dichloro-N-[2-(dimethylamino)ethyl]-N-methylpyridine-4-carboxamide |
| SMILES | CN(C)CCN(C)C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N3O/c1-15(2)4-5-16(3)11(17)8-6-9(12)14-10(13)7-8/h6-7H,4-5H2,1-3H3 |
| InChIKey | QTTQALSTDJMZSS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|