C10H12Cl2N2O2 — CID 106841536
2,6-dichloro-N-(4-hydroxybutyl)pyridine-4-carboxamide (PubChem CID 106841536) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-hydroxybutyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(4-hydroxybutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106841536 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2,6-dichloro-N-(4-hydroxybutyl)pyridine-4-carboxamide |
| SMILES | O=C(NCCCCO)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O2/c11-8-5-7(6-9(12)14-8)10(16)13-3-1-2-4-15/h5-6,15H,1-4H2,(H,13,16) |
| InChIKey | PMMUSSUTIBHHBZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|