C12H16F3N3OS — CID 106433006
2-amino-6-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide (PubChem CID 106433006) has the molecular formula C12H16F3N3OS and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-amino-6-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-6-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106433006 |
| Molecular Formula | C12H16F3N3OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-amino-6-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCCSC(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C12H16F3N3OS/c1-7(2)9-5-8(6-10(16)18-9)11(19)17-3-4-20-12(13,14)15/h5-7H,3-4H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | QOTMQWAZHRJXBO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|