C12H15F4N3O — CID 106295561
2-amino-6-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide (PubChem CID 106295561) has the molecular formula C12H15F4N3O and a molecular weight of 293.26 g/mol. Its IUPAC name is 2-amino-6-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106295561 |
| Molecular Formula | C12H15F4N3O |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-amino-6-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCC(F)(F)C(F)F)cc(N)n1 |
| InChI | InChI=1S/C12H15F4N3O/c1-6(2)8-3-7(4-9(17)19-8)10(20)18-5-12(15,16)11(13)14/h3-4,6,11H,5H2,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | PBEWXMSAJSMHFJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|