C10H11F4N3O — CID 114169847
2-amino-6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide (PubChem CID 114169847) has the molecular formula C10H11F4N3O and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-amino-6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114169847 |
| Molecular Formula | C10H11F4N3O |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-amino-6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(F)(F)C(F)F)cc(N)n1 |
| InChI | InChI=1S/C10H11F4N3O/c1-5-2-6(3-7(15)17-5)8(18)16-4-10(13,14)9(11)12/h2-3,9H,4H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | PBJGBFCIQQSBGL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|