C11H12F4N2O3S — CID 106289195
3-amino-5-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106289195) has the molecular formula C11H12F4N2O3S and a molecular weight of 328.29 g/mol. Its IUPAC name is 3-amino-5-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 3-amino-5-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106289195 |
| Molecular Formula | C11H12F4N2O3S |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-amino-5-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(N)cc(C(=O)NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H12F4N2O3S/c1-21(19,20)8-3-6(2-7(16)4-8)9(18)17-5-11(14,15)10(12)13/h2-4,10H,5,16H2,1H3,(H,17,18) |
| InChIKey | CPFXGJGFTMSFLW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|