C14H18N2O3S — CID 106223517
3-amino-N-hex-1-yn-3-yl-5-methylsulfonylbenzamide (PubChem CID 106223517) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-amino-N-hex-1-yn-3-yl-5-methylsulfonylbenzamide.
| Compound Name | 3-amino-N-hex-1-yn-3-yl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 106223517 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-amino-N-hex-1-yn-3-yl-5-methylsulfonylbenzamide |
| SMILES | C#CC(CCC)NC(=O)c1cc(N)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H18N2O3S/c1-4-6-12(5-2)16-14(17)10-7-11(15)9-13(8-10)20(3,18)19/h2,7-9,12H,4,6,15H2,1,3H3,(H,16,17) |
| InChIKey | BDAZKCRGXJSWRG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|