C11H12N2O3S — CID 55009391
3-amino-5-methylsulfonyl-N-prop-2-ynylbenzamide (PubChem CID 55009391) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-amino-5-methylsulfonyl-N-prop-2-ynylbenzamide.
| Compound Name | 3-amino-5-methylsulfonyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 55009391 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-amino-5-methylsulfonyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1cc(N)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-3-4-13-11(14)8-5-9(12)7-10(6-8)17(2,15)16/h1,5-7H,4,12H2,2H3,(H,13,14) |
| InChIKey | AGIXDWVWXWOPIV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|