C14H20N2O4S — CID 114464857
3-amino-N-[2-(2-methylprop-2-enoxy)ethyl]-5-methylsulfonylbenzamide (PubChem CID 114464857) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methylprop-2-enoxy)ethyl]-5-methylsulfonylbenzamide.
| Compound Name | 3-amino-N-[2-(2-methylprop-2-enoxy)ethyl]-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 114464857 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-amino-N-[2-(2-methylprop-2-enoxy)ethyl]-5-methylsulfonylbenzamide |
| SMILES | C=C(C)COCCNC(=O)c1cc(N)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H20N2O4S/c1-10(2)9-20-5-4-16-14(17)11-6-12(15)8-13(7-11)21(3,18)19/h6-8H,1,4-5,9,15H2,2-3H3,(H,16,17) |
| InChIKey | GWUJKDUHSLDXRL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|