C11H16N2O6S2 — CID 65375749
N-(2-methoxyethyl)-3-methylsulfonyl-5-sulfamoylbenzamide (PubChem CID 65375749) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-methylsulfonyl-5-sulfamoylbenzamide.
| Compound Name | N-(2-methoxyethyl)-3-methylsulfonyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375749 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(2-methoxyethyl)-3-methylsulfonyl-5-sulfamoylbenzamide |
| SMILES | COCCNC(=O)c1cc(S(C)(=O)=O)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O6S2/c1-19-4-3-13-11(14)8-5-9(20(2,15)16)7-10(6-8)21(12,17)18/h5-7H,3-4H2,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | WEKJRSYDVVIMEG-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|