C12H13F3N2O3S — CID 106208285
3-amino-5-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide (PubChem CID 106208285) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is 3-amino-5-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide.
| Compound Name | 3-amino-5-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 106208285 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-amino-5-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide |
| SMILES | CS(=O)(=O)c1cc(N)cc(C(=O)NC2(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C12H13F3N2O3S/c1-21(19,20)9-5-7(4-8(16)6-9)10(18)17-11(2-3-11)12(13,14)15/h4-6H,2-3,16H2,1H3,(H,17,18) |
| InChIKey | WKRWMZHUEWEXJH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|