C12H12F4N2O — CID 106208197
3-amino-5-fluoro-4-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide (PubChem CID 106208197) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide.
| Compound Name | 3-amino-5-fluoro-4-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 106208197 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-amino-5-fluoro-4-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide |
| SMILES | Cc1c(N)cc(C(=O)NC2(C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C12H12F4N2O/c1-6-8(13)4-7(5-9(6)17)10(19)18-11(2-3-11)12(14,15)16/h4-5H,2-3,17H2,1H3,(H,18,19) |
| InChIKey | WKJXYJJVWLRVSW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|