C11H12F3N3O — CID 106218219
4-amino-6-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide (PubChem CID 106218219) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-amino-6-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide.
| Compound Name | 4-amino-6-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106218219 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-amino-6-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(N)c(C(=O)NC2(C(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C11H12F3N3O/c1-6-4-8(15)7(5-16-6)9(18)17-10(2-3-10)11(12,13)14/h4-5H,2-3H2,1H3,(H2,15,16)(H,17,18) |
| InChIKey | GVNQNGOXBNKDBS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |