C12H16F4N4O — CID 106295650
2-hydrazinyl-6-propyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide (PubChem CID 106295650) has the molecular formula C12H16F4N4O and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-hydrazinyl-6-propyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide.
| Compound Name | 2-hydrazinyl-6-propyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106295650 |
| Molecular Formula | C12H16F4N4O |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-hydrazinyl-6-propyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NCC(F)(F)C(F)F)cc(NN)n1 |
| InChI | InChI=1S/C12H16F4N4O/c1-2-3-8-4-7(5-9(19-8)20-17)10(21)18-6-12(15,16)11(13)14/h4-5,11H,2-3,6,17H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | KLOHZALVAHYZHI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|