C14H22N4O — CID 113381146
N-(2,2-dimethylcyclopropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide (PubChem CID 113381146) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide.
| Compound Name | N-(2,2-dimethylcyclopropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 113381146 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-(2,2-dimethylcyclopropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NC2CC2(C)C)cc(NN)n1 |
| InChI | InChI=1S/C14H22N4O/c1-4-5-10-6-9(7-12(16-10)18-15)13(19)17-11-8-14(11,2)3/h6-7,11H,4-5,8,15H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | OTGMXJSSQOIIET-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|