C15H21ClN2O2 — CID 114629350
2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-propylpyridine-4-carboxamide (PubChem CID 114629350) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-propylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 114629350 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)-6-propylpyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NC2CC(O)C2(C)C)cc(Cl)n1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-4-5-10-6-9(7-13(16)17-10)14(20)18-11-8-12(19)15(11,2)3/h6-7,11-12,19H,4-5,8H2,1-3H3,(H,18,20) |
| InChIKey | WKFLKFIWDMHSOH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|