C15H26N4O2 — CID 114944205
N-(2-ethoxy-2-methylpropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide (PubChem CID 114944205) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(2-ethoxy-2-methylpropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide.
| Compound Name | N-(2-ethoxy-2-methylpropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 114944205 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-(2-ethoxy-2-methylpropyl)-2-hydrazinyl-6-propylpyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NCC(C)(C)OCC)cc(NN)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-5-7-12-8-11(9-13(18-12)19-16)14(20)17-10-15(3,4)21-6-2/h8-9H,5-7,10,16H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | HYDFLJXXSPSNFM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|