C8H9F4N5O — CID 106295652
5-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2-carboxamide (PubChem CID 106295652) has the molecular formula C8H9F4N5O and a molecular weight of 267.19 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106295652 |
| Molecular Formula | C8H9F4N5O |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)NCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C8H9F4N5O/c9-7(10)8(11,12)3-16-6(18)4-1-15-5(17-13)2-14-4/h1-2,7H,3,13H2,(H,15,17)(H,16,18) |
| InChIKey | ARNPRJSDYYZDRE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|