C10H9F4N3OS — CID 106292859
5-carbamothioyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide (PubChem CID 106292859) has the molecular formula C10H9F4N3OS and a molecular weight of 295.26 g/mol. Its IUPAC name is 5-carbamothioyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106292859 |
| Molecular Formula | C10H9F4N3OS |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-carbamothioyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide |
| SMILES | NC(=S)c1ccc(C(=O)NCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C10H9F4N3OS/c11-9(12)10(13,14)4-17-8(18)6-2-1-5(3-16-6)7(15)19/h1-3,9H,4H2,(H2,15,19)(H,17,18) |
| InChIKey | OOMRSEBFWSKTSA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|