C11H12F3N3O2S — CID 107479775
5-carbamothioyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 107479775) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 5-carbamothioyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107479775 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-carbamothioyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | NC(=S)c1ccc(C(=O)N(CCO)CC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H12F3N3O2S/c12-11(13,14)6-17(3-4-18)10(19)8-2-1-7(5-16-8)9(15)20/h1-2,5,18H,3-4,6H2,(H2,15,20) |
| InChIKey | NGOWIIKWIVIWJY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|