C11H9BrF6N2O — CID 107492556
N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 107492556) has the molecular formula C11H9BrF6N2O and a molecular weight of 379.10 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107492556 |
| Molecular Formula | C11H9BrF6N2O |
| Molecular Weight | 379.10 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(c1ccc(C(F)(F)F)cn1)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H9BrF6N2O/c12-3-4-20(6-10(13,14)15)9(21)8-2-1-7(5-19-8)11(16,17)18/h1-2,5H,3-4,6H2 |
| InChIKey | HREBIUUAXCYBKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|