C12H14F3N3OS — CID 114908478
N-(2-amino-2-sulfanylideneethyl)-N-propyl-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 114908478) has the molecular formula C12H14F3N3OS and a molecular weight of 305.32 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N-propyl-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N-propyl-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114908478 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N-propyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCCN(CC(N)=S)C(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H14F3N3OS/c1-2-5-18(7-10(16)20)11(19)9-4-3-8(6-17-9)12(13,14)15/h3-4,6H,2,5,7H2,1H3,(H2,16,20) |
| InChIKey | MQHCJSYNCAUALV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|