C12H14ClF3N2O2 — CID 114909425
N-(2-chloroethyl)-N-(2-methoxyethyl)-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 114909425) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2-methoxyethyl)-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2-methoxyethyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114909425 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(2-chloroethyl)-N-(2-methoxyethyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | COCCN(CCCl)C(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H14ClF3N2O2/c1-20-7-6-18(5-4-13)11(19)10-3-2-9(8-17-10)12(14,15)16/h2-3,8H,4-7H2,1H3 |
| InChIKey | RIVWLRWWYCEFQM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|