C12H14ClF3N2O2 — CID 106306680
N-[3-(2-chloroethoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 106306680) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is N-[3-(2-chloroethoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-(2-chloroethoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106306680 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[3-(2-chloroethoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCOCCCl)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H14ClF3N2O2/c13-4-7-20-6-1-5-17-11(19)10-3-2-9(8-18-10)12(14,15)16/h2-3,8H,1,4-7H2,(H,17,19) |
| InChIKey | WTBVURXNDKVDCA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|