C11H10ClF3N2O — CID 114909073
N-[(E)-4-chlorobut-2-enyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 114909073) has the molecular formula C11H10ClF3N2O and a molecular weight of 278.66 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114909073 |
| Molecular Formula | C11H10ClF3N2O |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NC/C=C/CCl)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H10ClF3N2O/c12-5-1-2-6-16-10(18)9-4-3-8(7-17-9)11(13,14)15/h1-4,7H,5-6H2,(H,16,18)/b2-1+ |
| InChIKey | DBTYHLGWSRLYIC-OWOJBTEDSA-N |
| XLogP | 2.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|