C14H12F3N3O — CID 114750435
N-[4-(aminomethyl)phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 114750435) has the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114750435 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | NCc1ccc(NC(=O)c2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C14H12F3N3O/c15-14(16,17)10-3-6-12(19-8-10)13(21)20-11-4-1-9(7-18)2-5-11/h1-6,8H,7,18H2,(H,20,21) |
| InChIKey | HXWUUPBEXPZRDI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |