C12H9F3N4O — CID 24896989
5-amino-N-[5-(trifluoromethyl)-2-pyridinyl]pyridine-2-carboxamide (PubChem CID 24896989) has the molecular formula C12H9F3N4O and a molecular weight of 282.23 g/mol. Its IUPAC name is 5-amino-N-[5-(trifluoromethyl)-2-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 5-amino-N-[5-(trifluoromethyl)-2-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 24896989 |
| Molecular Formula | C12H9F3N4O |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 5-amino-N-[5-(trifluoromethyl)-2-pyridinyl]pyridine-2-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2ccc(C(F)(F)F)cn2)nc1 |
| InChI | InChI=1S/C12H9F3N4O/c13-12(14,15)7-1-4-10(18-5-7)19-11(20)9-3-2-8(16)6-17-9/h1-6H,16H2,(H,18,19,20) |
| InChIKey | GVJUWDLEZKSQLI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |