C11H6ClF3N4O — CID 107595663
N-(5-chloropyrazin-2-yl)-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 107595663) has the molecular formula C11H6ClF3N4O and a molecular weight of 302.64 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107595663 |
| Molecular Formula | C11H6ClF3N4O |
| Molecular Weight | 302.64 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cnc(Cl)cn1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H6ClF3N4O/c12-8-4-18-9(5-17-8)19-10(20)7-2-1-6(3-16-7)11(13,14)15/h1-5H,(H,18,19,20) |
| InChIKey | IJFZGVIKMXOTNE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |